3-amino-5-chloropyridazine manufacturers
|
| | 3-amino-5-chloropyridazine Basic information |
| | 3-amino-5-chloropyridazine Chemical Properties |
| Melting point | >124°C (dec.) | | Boiling point | 368.3±22.0 °C(Predicted) | | density | 1.437±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3+-.0.10(Predicted) | | color | Pale Brown to Brown | | InChI | InChI=1S/C4H4ClN3/c5-3-1-4(6)8-7-2-3/h1-2H,(H2,6,8) | | InChIKey | FLLHRDDIQGNYLR-UHFFFAOYSA-N | | SMILES | C1(N)=NN=CC(Cl)=C1 |
| | 3-amino-5-chloropyridazine Usage And Synthesis |
| Uses | 5-Chloropyridazin-3-amine is an intermediate used to prepare aminopyrazines as novel, potent Nav1.7 antagonists. |
| | 3-amino-5-chloropyridazine Preparation Products And Raw materials |
|