| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Urea-d4 CAS:1433-11-0 Package:10g,1g
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Urea-d4 CAS:1433-11-0 Remarks:CS-C-00294
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Urea-d4 CAS:1433-11-0 Purity:98 atom % D Package:25G Remarks:176087-25G
|
|
| | UREA-D4 Basic information |
| | UREA-D4 Chemical Properties |
| Melting point | 132-135 °C (lit.) | | storage temp. | Room Temperature, Under inert atmosphere | | solubility | DMSO (Sparingly, Sonicated), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/CH4N2O/c2-1(3)4/h(H4,2,3,4)/i/hD4 | | InChIKey | XSQUKJJJFZCRTK-JBISRTOLSA-N | | SMILES | [2H]N([2H])C(=O)N([2H])[2H] | | CAS Number Unlabeled | 57-13-6 |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-40 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | UREA-D4 Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | Labelled Urea. Physiological regulator of nitrogen excretion in mammals; synthesized in the liver as an end-product of protein catabolism and excreted in urine. Also occurs normally in skin. Emollient; diuretic. |
| | UREA-D4 Preparation Products And Raw materials |
|