| Company Name: |
NovoChemy Ltd. |
| Tel: |
86-(0)21-31261262 373522135 |
| Email: |
sales@novochemy.com |
6-oxabicyclo[3.1.0]hex-3-ene manufacturers
|
| | 6-oxabicyclo[3.1.0]hex-3-ene Basic information |
| Product Name: | 6-oxabicyclo[3.1.0]hex-3-ene | | Synonyms: | 6-oxabicyclo[3.1.0]hex-3-ene;2,4a-dihydro-1AH-cyclopenta[b]oxirene;6-Oxabicyclo[3.1.0]hex-2-ene, 95+%;6-oxybiscyclo[3.1.0]hexyl-3-ene | | CAS: | 7129-41-1 | | MF: | C5H6O | | MW: | 82.1 | | EINECS: | | | Product Categories: | | | Mol File: | 7129-41-1.mol | ![6-oxabicyclo[3.1.0]hex-3-ene Structure](CAS/20150408/GIF/7129-41-1.gif) |
| | 6-oxabicyclo[3.1.0]hex-3-ene Chemical Properties |
| Melting point | -53-55 °C | | Boiling point | 112 °C(Press: 764 Torr) | | density | 1.0217 g/cm3(Temp: 25 °C) | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C5H6O/c1-2-4-5(3-1)6-4/h1-2,4-5H,3H2 | | InChIKey | ASZFCDOTGITCJI-UHFFFAOYSA-N | | SMILES | C12C(O1)CC=C2 |
| | 6-oxabicyclo[3.1.0]hex-3-ene Usage And Synthesis |
| | 6-oxabicyclo[3.1.0]hex-3-ene Preparation Products And Raw materials |
|