(R)-(-)-1,1'-Binaphthol-2,2'-bis(trifluoromethanesulfonate) manufacturers
|
| | (R)-(-)-1,1'-Binaphthol-2,2'-bis(trifluoromethanesulfonate) Basic information |
| Product Name: | (R)-(-)-1,1'-Binaphthol-2,2'-bis(trifluoromethanesulfonate) | | Synonyms: | 1,1'-BIS(2-NAPHTHOL) DITRIFLATE;1,1'-BINAPHTHYL-2,2'-DIYL BIS(TRIFLUOROMETHANESULPHONATE);1,1'-BI-2-NAPHTHOL BIS(TRIFLUOROMETHANESULFONATE);1,1-BI-2-NAPHTHOL BIS(TRIFLUOROMETHANESULFONATE);1,1'-BI-2-NAPHTHOL-BIS(TRIFLUOROMETHANESULPHONATE);(R)-(-)-1,1`-Bi-2-naphthyl bis(trifluoromethanesulphonate);(R)1,1'-BINAPHTHALENE-2,2'-DIYL BIS(TRI- FLUOROMETHANESULF.);(R)-(-9-1,1'-BINAPHTHYL-2,2'-DIYL BIS-(TRIFLUOROMETHANESULFONATE) | | CAS: | 126613-06-7 | | MF: | C22H12F6O6S2 | | MW: | 550.45 | | EINECS: | | | Product Categories: | API intermediates;Asymmetric Synthesis;Synthetic Organic Chemistry;BINOL Series;Chiral Oxygen | | Mol File: | 126613-06-7.mol |  |
| | (R)-(-)-1,1'-Binaphthol-2,2'-bis(trifluoromethanesulfonate) Chemical Properties |
| Melting point | 83-85 °C(lit.) | | alpha | -149 º (c=1, CHCl3) | | Boiling point | 578.8±50.0 °C(Predicted) | | density | 1.5402 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | color | White | | Optical Rotation | [α]23/D 146°, c = 1 in chloroform | | Water Solubility | Insoluble | | Sensitive | moisture sensitive | | BRN | 4282753 | | InChI | InChI=1S/C22H12F6O6S2/c23-21(24,25)35(29,30)33-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)34-36(31,32)22(26,27)28/h1-12H | | InChIKey | OYJLCOSEYYZULE-UHFFFAOYSA-N | | SMILES | C1(=C(OS(=O)(=O)C(F)(F)F)C=CC2C=CC=CC1=2)C1C(OS(=O)(=O)C(F)(F)F)=CC=C2C=CC=CC=12 | | CAS DataBase Reference | 126613-06-7(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29072990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | (R)-(-)-1,1'-Binaphthol-2,2'-bis(trifluoromethanesulfonate) Usage And Synthesis |
| Chemical Properties | white powder | | Uses | (R)-()-1,1′-Bi-2-naphthol bis(trifluoromethanesulfonate) can be used:
- In the synthesis of heterobidentate ligands for asymmetric catalysis.
- To prepare 2-(diphenylphosphino)-2′-alkoxy-1,1′-binaphthyls by reacting with bis(aryl) phosphonic acids.
- As a starting material for the synthesis of binaphthyl based rhodium catalysts used in the hydrogenation of styrene.
|
| | (R)-(-)-1,1'-Binaphthol-2,2'-bis(trifluoromethanesulfonate) Preparation Products And Raw materials |
|