Benzo[1,2-b:6,5-b']dithiophene-4,5-dione manufacturers
|
| | Benzo[1,2-b:6,5-b']dithiophene-4,5-dione Basic information |
| Product Name: | Benzo[1,2-b:6,5-b']dithiophene-4,5-dione | | Synonyms: | 6,5-b']dithiophene-4,5-dione;Benzo[1,2-b:6,5-b']dithiophene-4,5-dione;IN1799, Benzo[1,2-b:6,5-b']dithiophene-4,5-dione;EA700;Benzo[1,2-b:6,5-b’]dithiophene-4,5-dione;benzenebenzo[1,2-B:6,5-B′]dithiophene-4,5-dione;benzo[2,1-b:3,4-b']dithiophene-4,5-dione;Benzo[2,1-b:3,4-b']dithiophene-4,5-dione | | CAS: | 24243-32-1 | | MF: | C10H4O2S2 | | MW: | 220.27 | | EINECS: | 946-129-4 | | Product Categories: | | | Mol File: | 24243-32-1.mol | ![Benzo[1,2-b:6,5-b']dithiophene-4,5-dione Structure](CAS/20180808/GIF/24243-32-1.gif) |
| | Benzo[1,2-b:6,5-b']dithiophene-4,5-dione Chemical Properties |
| Boiling point | 422.8±20.0 °C(Predicted) | | density | 1.595±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | Brown to black Solid | | InChI | InChI=1S/C10H4O2S2/c11-7-5-1-3-13-9(5)10-6(8(7)12)2-4-14-10/h1-4H | | InChIKey | HRKPZDPFRDQSKZ-UHFFFAOYSA-N | | SMILES | C12C3SC=CC=3C(=O)C(=O)C=1C=CS2 |
| | Benzo[1,2-b:6,5-b']dithiophene-4,5-dione Usage And Synthesis |
| | Benzo[1,2-b:6,5-b']dithiophene-4,5-dione Preparation Products And Raw materials |
|