| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
|
| | 5-BroMo-2,3-dihydroxybenzaldehyde Basic information | | Uses |
| | 5-BroMo-2,3-dihydroxybenzaldehyde Chemical Properties |
| Melting point | 128-130 °C | | Boiling point | 283.2±35.0 °C(Predicted) | | density | 1.901±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 7.45±0.23(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C7H5BrO3/c8-5-1-4(3-9)7(11)6(10)2-5/h1-3,10-11H | | InChIKey | QOJBBGBTZFXYBV-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(Br)=CC(O)=C1O |
| | 5-BroMo-2,3-dihydroxybenzaldehyde Usage And Synthesis |
| Uses | 5-Bromo-2,3-dihydroxybenzaldehyde can be used in pharmaceutical synthesis and scientific research. |
| | 5-BroMo-2,3-dihydroxybenzaldehyde Preparation Products And Raw materials |
|