|
|
| | benzene-1,3,5-tricarbohydrazide Basic information | | Uses |
| Product Name: | benzene-1,3,5-tricarbohydrazide | | Synonyms: | benzene-1,3,5-tricarbohydrazide;benzene-1,3,5-tricarboxylic acid trihydrazide;1,3,5-Benzenetricarboxylic acid, 1,3,5-trihydrazide;1，3，5-benzenetriformylhydrazine | | CAS: | 36997-31-6 | | MF: | C9H12N6O3 | | MW: | 252.23 | | EINECS: | | | Product Categories: | | | Mol File: | 36997-31-6.mol |  |
| | benzene-1,3,5-tricarbohydrazide Chemical Properties |
| Melting point | 300 °C (decomp) | | density | 1.466±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 11.22±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H12N6O3/c10-13-7(16)4-1-5(8(17)14-11)3-6(2-4)9(18)15-12/h1-3H,10-12H2,(H,13,16)(H,14,17)(H,15,18) | | InChIKey | MNBHRGAIQJFCIO-UHFFFAOYSA-N | | SMILES | C(C1C=C(C(=O)NN)C=C(C(=O)NN)C=1)(=O)NN |
| | benzene-1,3,5-tricarbohydrazide Usage And Synthesis |
| Uses | 1,3,5-Benzotricarboxyhydrazide is a carboxylic acid derivative that can be used in laboratory research and development processes as well as in chemical and pharmaceutical synthesis. |
| | benzene-1,3,5-tricarbohydrazide Preparation Products And Raw materials |
|