| Company Name: |
DILICHEM Gold |
| Tel: |
0519-0519-81238123 18014346496 |
| Email: |
shichaojun@126.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-nitro-4-bromo-5-fluoroanisole Basic information |
| Product Name: | 2-nitro-4-bromo-5-fluoroanisole | | Synonyms: | 2-nitro-4-bromo-5-fluoroanisole;4-Bromo-5-fluoro-2-nitroanisole;Benzene, 1-bromo-2-fluoro-4-methoxy-5-nitro-;2-Nitro-4-Bromo-5-fluorobenzyl ether;1-bromo-2-fluoro-4-methoxy-5-nitrobenzene | | CAS: | 1352244-77-9 | | MF: | C7H5BrFNO3 | | MW: | 250.02 | | EINECS: | | | Product Categories: | | | Mol File: | 1352244-77-9.mol |  |
| | 2-nitro-4-bromo-5-fluoroanisole Chemical Properties |
| Boiling point | 290.5±35.0 °C(Predicted) | | density | 1.716±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Appearance | White to yellow Solid | | InChI | InChI=1S/C7H5BrFNO3/c1-13-7-3-5(9)4(8)2-6(7)10(11)12/h2-3H,1H3 | | InChIKey | DHSGXAGGBXJPEL-UHFFFAOYSA-N | | SMILES | C1(Br)=CC([N+]([O-])=O)=C(OC)C=C1F |
| | 2-nitro-4-bromo-5-fluoroanisole Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 1-bromo-2-fluoro-4-methoxy-5-nitrobenzene from 4-bromo-3-fluoroanisole: To a solution of 1-bromo-2-fluoro-4-methoxybenzene (5.00 g, 24.39 mmol) in sulphuric acid (20.0 mL) was added potassium nitrate (2.47 g, 24.39 mmol) in batches at 0 °C. The reaction mixture was stirred continuously at 0°C for 0.5 hr. The progress of the reaction was monitored by thin layer chromatography (TLC, unfolding agent ratio of petroleum ether: ethyl acetate = 3:1) to confirm the completion of the reaction. The reaction mixture was quenched by slowly pouring into ice water (50.0 mL) and extracted with ethyl acetate (100 mL x 2). The organic layers were combined, dried with anhydrous sodium sulfate, filtered and concentrated to dryness under reduced pressure to afford 1-bromo-2-fluoro-4-methoxy-5-nitrobenzene (5.55 g, 90% yield) as a white solid. | | References | [1] Patent: CN105330698, 2016, A. Location in patent: Paragraph 0566; 0567; 0568; 0569 |
| | 2-nitro-4-bromo-5-fluoroanisole Preparation Products And Raw materials |
|