|
|
| | (1R,2S)-2-Phenyl-cyclopropylamine hydrochloride Basic information |
| Product Name: | (1R,2S)-2-Phenyl-cyclopropylamine hydrochloride | | Synonyms: | (+)-Tranylcypromine and (-)-Tranylcypromine;(1R,2S)-2-Phenyl-cyclopropylamine hydrochloride;(1R,2S)-2-phenylcyclopropan-1-amine hydrochloride;(-)-Tranylcypromine HCl;(1R,2S)-Tranylcypromine Hydrochloride;(-)-Tranylcypromine HydrochlorideQ: What is
(-)-Tranylcypromine Hydrochloride Q: What is the CAS Number of
(-)-Tranylcypromine Hydrochloride Q: What is the storage condition of
(-)-Tranylcypromine Hydrochloride;(-)-Tranylcypromine HCl ((-)-trans-2-Phenylcyclopropylamine HCl);S(-) Enantiomer of Tranylcypromine | | CAS: | 37388-05-9 | | MF: | C9H12ClN | | MW: | 169.65 | | EINECS: | | | Product Categories: | | | Mol File: | 37388-05-9.mol |  |
| | (1R,2S)-2-Phenyl-cyclopropylamine hydrochloride Chemical Properties |
| InChI | InChI=1/C9H11N.ClH/c10-9-6-8(9)7-4-2-1-3-5-7;/h1-5,8-9H,6,10H2;1H/t8-,9+;/s3 | | InChIKey | ZPEFMSTTZXJOTM-HLRUTPIHNA-N | | SMILES | N[C@@H]1C[C@H]1C1C=CC=CC=1.Cl |&1:1,3,r| |
| | (1R,2S)-2-Phenyl-cyclopropylamine hydrochloride Usage And Synthesis |
| Uses | (1R,2S)-Tranylcypromine Hydrochloride, is used in the preparation of piperidine derivatives, which serve as LSD1 inhibitors for the treatment of cancer. (1R,2S)-Tranylcypromine-d5 Hydrochloride has also been shown to inhibit gastric emptying in rats. | | Definition | ChEBI: (1R,2S)-tranylcypromine hydrochloride is a hydrochloride obtained by combining (1R,2S)-tranylcypromine with one equivalent of hydrochloric acid. It contains a (1R,2S)-tranylcypromine(1+). It is an enantiomer of a (1S,2R)-tranylcypromine hydrochloride. |
| | (1R,2S)-2-Phenyl-cyclopropylamine hydrochloride Preparation Products And Raw materials |
|