|
|
| | 5-Chloro-2-(4-fluoro-phenoxy)-benzoic acid Basic information |
| | 5-Chloro-2-(4-fluoro-phenoxy)-benzoic acid Chemical Properties |
| Boiling point | 363.6±37.0 °C(Predicted) | | density | 1.413±0.06 g/cm3(Predicted) | | form | solid | | pka | 3.84±0.36(Predicted) | | InChI | 1S/C13H8ClFO3/c14-8-1-6-12(11(7-8)13(16)17)18-10-4-2-9(15)3-5-10/h1-7H,(H,16,17) | | InChIKey | MTUBNWMHXHNBLO-UHFFFAOYSA-N | | SMILES | O=C(O)C1=CC(Cl)=CC=C1OC2=CC=C(F)C=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-Chloro-2-(4-fluoro-phenoxy)-benzoic acid Usage And Synthesis |
| | 5-Chloro-2-(4-fluoro-phenoxy)-benzoic acid Preparation Products And Raw materials |
|