|
|
| | N-Boc-O-tosyl hydroxylamine Basic information |
| Product Name: | N-Boc-O-tosyl hydroxylamine | | Synonyms: | N-Boc-O-tosyl hydroxylamine;Carbamic acid, [[(4-methylphenyl)sulfonyl]oxy]-, 1,1-dimethylethyl ester;[[(4-Methylphenyl)sulfonyl]oxy]carbamic acid 1,1-dimethylethyl ester;Benzenesulfonic acid, 4-methyl-, [(1,1-dimethylethoxy)carbonyl]azanyl ester;inhibit,N Boc O tosyl hydroxylamine,NBocOtosyl hydroxylamine,Inhibitor;N-Boc-O-tosyl hydroxylamine, 10 mM in DMSO;N-Boc-O-tosylhydroxylamine;N-Boc-O-tosyl hydroxylamine - [B71749] | | CAS: | 105838-14-0 | | MF: | C12H17NO5S | | MW: | 287.33 | | EINECS: | | | Product Categories: | | | Mol File: | 105838-14-0.mol |  |
| | N-Boc-O-tosyl hydroxylamine Chemical Properties |
| Melting point | 97 °C (decomp) | | density | 1.237±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Ethyl Acetate | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C12H17NO5S/c1-9-5-7-10(8-6-9)19(15,16)18-13-11(14)17-12(2,3)4/h5-8H,1-4H3,(H,13,14) | | InChIKey | WZDPZKPHVNFUKB-UHFFFAOYSA-N | | SMILES | C1(S(ONC(OC(C)(C)C)=O)(=O)=O)=CC=C(C)C=C1 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | N-Boc-O-tosyl hydroxylamine Usage And Synthesis |
| Uses | Electrophilic N-amination of aryl and alkyl amines. |
| | N-Boc-O-tosyl hydroxylamine Preparation Products And Raw materials |
|