| Company Name: |
Beijing HwrkChemical Technology Co., Ltd
|
| Tel: |
89508211 18501085097 |
| Email: |
sales.bj@hwrkchemical.com |
| Products Intro: |
Product Name:(4-trimethylsilylpyridin-3-yl) trifluoromethanesulfonate CAS:1211583-40-2 Purity:97% Package:1g/5g/100g Remarks:HWM104777
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Garg 3,4-pyridine precursor CAS:1211583-40-2 Purity:97% Package:100MG Remarks:795658-100MG
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Garg 3,4-pyridine precursor 97% CAS:1211583-40-2 Purity:97% Package:100mg;1g Remarks:NULL
|
| Company Name: |
Shanghai Maclean Biochemical Technology Co., LTD
|
| Tel: |
021-50706066 15221275939 |
| Email: |
shenlinxing@macklin.cn |
| Products Intro: |
Product Name:4-(Trimethylsilyl)pyridin-3-yl trifluoromethanesulfonate CAS:1211583-40-2 Purity:97% Package:100mg
|
|
| | 4-(Trimethylsilyl)pyridin-3-yl trifluoromethanesulfonate Basic information |
| | 4-(Trimethylsilyl)pyridin-3-yl trifluoromethanesulfonate Chemical Properties |
| density | 1.259 at 25 °C | | refractive index | n/D1.455 | | Fp | >110℃ | | storage temp. | 2-8°C | | form | liquid | | InChI | 1S/C9H12F3NO3SSi/c1-18(2,3)8-4-5-13-6-7(8)16-17(14,15)9(10,11)12/h4-6H,1-3H3 | | InChIKey | HJIBLRJECSPWKZ-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)C1=C(OS(=O)(C(F)(F)F)=O)C=NC=C1 |
| Risk Statements | 36 | | Safety Statements | 26 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(Trimethylsilyl)pyridin-3-yl trifluoromethanesulfonate Usage And Synthesis |
| Uses | Pyridyne precursor can be activated under mild fluoride conditions; which are highly reactive with dienes and other dipolariphiles (e.g. azides) to provide cycloaddition products containing an indole motif. |
| | 4-(Trimethylsilyl)pyridin-3-yl trifluoromethanesulfonate Preparation Products And Raw materials |
|