| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (E)-4-[(4-Hydroxyphenyl)azo]benzoic acid Basic information |
| Product Name: | (E)-4-[(4-Hydroxyphenyl)azo]benzoic acid | | Synonyms: | (E)-4-[(4-Hydroxyphenyl)azo]benzoic acid;4-(4'-Hydroxyphenylazo)benzoic acid 97%;Benzoic acid, 4-[(1E)-(4-hydroxyphenyl)azo]-;4-[(1E)-(4-Hydroxyphenyl)azo]benzoic acid;4-[(1E)-2-(4-hydroxyphenyl)diazen-1-yl]benzoic acid | | CAS: | 105299-45-4 | | MF: | C13H10N2O3 | | MW: | 242.23 | | EINECS: | | | Product Categories: | | | Mol File: | 105299-45-4.mol | ![(E)-4-[(4-Hydroxyphenyl)azo]benzoic acid Structure](CAS/20180629/GIF/105299-45-4.gif) |
| | (E)-4-[(4-Hydroxyphenyl)azo]benzoic acid Chemical Properties |
| Melting point | 270-280°C | | Boiling point | 497.7±30.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.94±0.10(Predicted) | | form | solid | | InChI | 1S/C13H10N2O3/c16-12-7-5-11(6-8-12)15-14-10-3-1-9(2-4-10)13(17)18/h1-8,16H,(H,17,18)/b15-14+ | | InChIKey | HLVCZTOFOWHIJZ-CCEZHUSRSA-N | | SMILES | OC(C1=CC=C(/N=N/C2=CC=C(O)C=C2)C=C1)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | (E)-4-[(4-Hydroxyphenyl)azo]benzoic acid Usage And Synthesis |
| Uses | 4-(4′-Hydroxyphenylazo)benzoic acid may be used to synthesize 4-(4-propyloxyphenylazo)benzoic acid via Williamson synthesis by reacting with 1-bromopropane. | | reaction suitability | reagent type: cross-linking reagent |
| | (E)-4-[(4-Hydroxyphenyl)azo]benzoic acid Preparation Products And Raw materials |
|