Fmoc-Val-Gly-OH manufacturers
- Fmoc-Val-Gly-OH
-
- $2.00
-
2026-08-25
- CAS:142810-19-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | Fmoc-Val-Gly-OH Basic information |
| Product Name: | Fmoc-Val-Gly-OH | | Synonyms: | Fmoc-Val-Gly-OH;(9H-Fluoren-9-yl)MethOxy]Carbonyl Val-Gly-OH;2-[(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]acetic acid;Glycine, N-[N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-valyl]-;(S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methylbutanamido)acetic acid;Glycine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-valyl-;MOC-VAL-GLY-OH;(Fmoc-L-valyl)-glycine | | CAS: | 142810-19-3 | | MF: | C22H24N2O5 | | MW: | 396.44 | | EINECS: | | | Product Categories: | | | Mol File: | 142810-19-3.mol |  |
| | Fmoc-Val-Gly-OH Chemical Properties |
| Melting point | 141°C (decomposition) | | Boiling point | 678.0±45.0 °C(Predicted) | | density | 1.258±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.38±0.10(Predicted) | | form | powder or crystals | | Appearance | White to light yellow Solid | | Optical Rotation | [α]22/D -14.0°, c = 0.5% in DMSO | | Major Application | peptide synthesis | | InChIKey | RWMPPRIMKZLKTB-FQEVSTJZSA-N | | SMILES | OC(CNC([C@H](C(C)C)NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)=O)=O |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| | Fmoc-Val-Gly-OH Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Val-Gly-OH Preparation Products And Raw materials |
|