| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Products Intro: |
Product Name:4-Chloro-α-cyanocinnamic acid
CAS:69727-07-7
Purity:matrix substance for MALDI-MS, ≥95.0% (HPLC) Package:1g;10g;100g;1KG;5KG
|
| Company Name: |
Tianjin Being Technology Co., Ltd.
|
| Tel: |
18622939839 |
| Email: |
tjby921@163.com |
| Products Intro: |
Product Name:3-(4-Chlorophenyl)-2-cyano-2-propenoic acid
CAS:69727-07-7
Package:100g
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58859352 18651614124 |
| Email: |
2881516338@qq.com |
| Products Intro: |
Product Name:3-(4-Chlorophenyl)-2-cyanoacrylic acid
CAS:69727-07-7
Purity:95%+ Package:1g;5g;10g
|
| Company Name: |
Cayman Chemical Company
|
| Tel: |
800-364-9897 |
| Email: |
sales@caymanchem.com |
| Products Intro: |
Product Name:4-chloro-α-Cyanocinnamic Acid
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:4-Chloro-α-cyanocinnamic acid
CAS:69727-07-7
|
|
| | NSC 2479 Basic information |
| Product Name: | NSC 2479 | | Synonyms: | 3-(4-Chlorophenyl)-2-cyano-2-propenoic acid;ClCCA;NSC 2479;p-Chlorobenzylidenecyanoacetic acid;p-Chloro-α-cyanocinnamic acid;2-Propenoic acid, 3-(4-chlorophenyl)-2-cyano-;4-Chloro-α-cyanocinnamic acid;3-(4-Chlorophenyl)-2-cyanoprop-2-enoic acid | | CAS: | 69727-07-7 | | MF: | C10H6ClNO2 | | MW: | 207.61 | | EINECS: | | | Product Categories: | | | Mol File: | 69727-07-7.mol |  |
| | NSC 2479 Chemical Properties |
| Melting point | 189-191.5 °C | | Boiling point | 377.0±32.0 °C(Predicted) | | density | 1.415±0.06 g/cm3(Predicted) | | solubility | methanol: soluble100mg/10 mL, clear, colorless to light yellow | | pka | 0.55±0.10(Predicted) | | form | solid | | BRN | 2616773 | | InChI | 1S/C10H6ClNO2/c11-9-3-1-7(2-4-9)5-8(6-12)10(13)14/h1-5H,(H,13,14)/b8-5+ | | InChIKey | MXCRRKYUQNHWLJ-VMPITWQZSA-N | | SMILES | OC(=O)\C(=C\c1ccc(Cl)cc1)C#N |
| Hazard Codes | T | | Risk Statements | 20/21-25 | | Safety Statements | 36/37-45 | | RIDADR | UN 3439 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation |
| | NSC 2479 Usage And Synthesis |
| Uses | - suitable as MALDI-Matrix material
- suitable for collision-induced dissociation MS/MS (CID-MS/MS)
|
| | NSC 2479 Preparation Products And Raw materials |
|