- 2-NITRO-4-CYMENE
-
- $0.10 / 1KG
-
2025-12-24
- CAS:943-15-7
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000 tons
- 2-NITRO-4-CYMENE
-
- $0.10 / 1KG
-
2019-12-25
- CAS:943-15-7
- Min. Order: 1KG
- Purity: 95%-99%
- Supply Ability: 1kg; 50kg; 500kg
|
| | 2-NITRO-4-CYMENE Basic information |
| Product Name: | 2-NITRO-4-CYMENE | | Synonyms: | 4-Isopropyl-1-methyl-2-nitrobenzene;4-isopropyl-1-methyl-2-nitro-benzene;4-Isopropyl-2-nitrotoluene;Benzene, 1-methyl-4-(1-methylethyl)-2-nitro-;Methyl-4-isopropyl-2-nitro-benzene;2-NITRO-PARA-CYMENE, TECH., 90%;1-METHYL-4-(1-METHYLETHYL)-2-NITROBENZENE;2-Nitro-4-cymene,90%,tech. | | CAS: | 943-15-7 | | MF: | C10H13NO2 | | MW: | 179.22 | | EINECS: | 213-397-2 | | Product Categories: | Nitro Compounds;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 943-15-7.mol |  |
| | 2-NITRO-4-CYMENE Chemical Properties |
| Melting point | 1°C (estimate) | | Boiling point | 134 °C / 15mmHg | | density | 1.07 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.528(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Light yellow to Yellow to Orange | | InChI | 1S/C10H13NO2/c1-7(2)9-5-4-8(3)10(6-9)11(12)13/h4-7H,1-3H3 | | InChIKey | DRKFWQDBPGTSOO-UHFFFAOYSA-N | | SMILES | CC(C)c1ccc(C)c(c1)[N+]([O-])=O | | EPA Substance Registry System | Benzene, 1-methyl-4-(1-methylethyl)-2-nitro- (943-15-7) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 36/37/39-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2904200090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-NITRO-4-CYMENE Usage And Synthesis |
| Chemical Properties | clear orange liquid | | Uses | 2-Nitro-p-cymene was used in the synthesis of 5 -isopropyl-8-methylquinoline. It was used as mediator solvent in perchlorate ion-selective electrode with poly(vinyl chloride) matrix membrane on conductive silver-epoxy composite. | | General Description | Reduction products of 2-nitro-p-cymene are significant dye intermediates. |
| | 2-NITRO-4-CYMENE Preparation Products And Raw materials |
|