- BOC-TRP(FOR)-OH
-
- $7.00 / 1KG
-
2019-09-02
- CAS:47355-10-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | BOC-TRP(FOR)-OH Basic information |
| | BOC-TRP(FOR)-OH Chemical Properties |
| Melting point | ~100 °C (dec.) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | very faint turbidity in Methanol | | pka | 3.82±0.10(Predicted) | | form | Powder | | color | White to off-white | | Optical Rotation | [α]20/D +19±2°, c = 2% in ethanol | | Sensitive | Light Sensitive | | BRN | 4299614 | | Major Application | peptide synthesis | | InChI | 1S/C17H20N2O5/c1-17(2,3)24-16(23)18-13(15(21)22)8-11-9-19(10-20)14-7-5-4-6-12(11)14/h4-7,9-10,13H,8H2,1-3H3,(H,18,23)(H,21,22)/t13-/m0/s1 | | InChIKey | IHXHBYFWSOYYTR-ZDUSSCGKSA-N | | SMILES | [n]1(c2c(c(c1)C[C@H](NC(=O)OC(C)(C)C)C(=O)O)cccc2)C=O | | CAS DataBase Reference | 47355-10-2 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 8 | | HS Code | 2933 99 80 | | Storage Class | 11 - Combustible Solids |
| | BOC-TRP(FOR)-OH Usage And Synthesis |
| Uses | Boc-Trp(For)-OH, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-TRP(FOR)-OH Preparation Products And Raw materials |
|