|
|
| | 2,5-DIISOPROPYLPHENOL Basic information |
| Product Name: | 2,5-DIISOPROPYLPHENOL | | Synonyms: | 2,5-DIISOPROPYLPHENOL;Einecs 252-807-4;Phenol, 2,5-bis(1-methylethyl)-;Propofol impurity D;Propofol EP Impurity D;p-Diisopropylbenzene monoalc.;Propofol Impurity 4(Propofol EP Impurity D);2,5-bis(1-methylethyl)phenol | | CAS: | 35946-91-9 | | MF: | C12H18O | | MW: | 178.27 | | EINECS: | 252-807-4 | | Product Categories: | | | Mol File: | 35946-91-9.mol |  |
| | 2,5-DIISOPROPYLPHENOL Chemical Properties |
| Melting point | 118-119 °C | | Boiling point | 115-120 °C | | density | 0.948±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Oil | | pka | 10.55±0.10(Predicted) | | color | Dark Red to Very Dark Red | | InChI | InChI=1S/C12H18O/c1-8(2)10-5-6-11(9(3)4)12(13)7-10/h5-9,13H,1-4H3 | | InChIKey | VFNUNYPYULIJSN-UHFFFAOYSA-N | | SMILES | C1(O)=CC(C(C)C)=CC=C1C(C)C | | EPA Substance Registry System | Phenol, 2,5-bis(1-methylethyl)- (35946-91-9) |
| | 2,5-DIISOPROPYLPHENOL Usage And Synthesis |
| Uses | 2,5-Diisopropylphenol (Propofol EP Impurity D) inhibits propofol glucuronidation of propofol (2,6-diisopropylphenol), an anesthetic. | | Definition | ChEBI: 2,5-diisopropylphenol is a monoterpenoid. |
| | 2,5-DIISOPROPYLPHENOL Preparation Products And Raw materials |
|