|
|
| | 2-Hydroxy-5-bromopyridine Basic information |
| | 2-Hydroxy-5-bromopyridine Chemical Properties |
| Melting point | 180-183 °C(lit.) | | Boiling point | 305.9±42.0 °C(Predicted) | | density | 1.776±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 9.96±0.10(Predicted) | | form | Crystalline Powder | | color | Off-white to yellow-brown | | BRN | 108751 | | InChI | InChI=1S/C5H4BrNO/c6-4-1-2-5(8)7-3-4/h1-3H,(H,7,8) | | InChIKey | NDMZZQRNZFWMEZ-UHFFFAOYSA-N | | SMILES | C1(=O)NC=C(Br)C=C1 | | CAS DataBase Reference | 13466-38-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-36-22 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Hydroxy-5-bromopyridine Usage And Synthesis |
| Chemical Properties | off-white to yellow-brown crystalline powder | | Uses | 5-Bromopyridin-2-ol is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | | General Description | 5-Bromo-2(1H)-pyridone undergoes difluormethylation in the presence of sodium chlorodifluoroacetate (ClCF2COONa) and methyl cyanide. |
| | 2-Hydroxy-5-bromopyridine Preparation Products And Raw materials |
|