DL-INDOLE-3-LACTIC ACID manufacturers
- Indolelactic acid
-
- $35.00 / 5mg
-
2026-02-01
- CAS:1821-52-9
- Min. Order:
- Purity: 99.76%
- Supply Ability: 10g
- DL-INDOLE-3-LACTIC ACID
-
- $0.00 / 25KG
-
2025-12-01
- CAS:1821-52-9
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | DL-INDOLE-3-LACTIC ACID Basic information |
| Product Name: | DL-INDOLE-3-LACTIC ACID | | Synonyms: | 3-INDOLE-LACTIC ACID;2-hydroxy-3-(1H-indol-3-yl)propanoate;3-(3-Indolyl)lactic Acid
2-Hydroxy-3-(3-indolyl)propionic Acid;3-(3-INDOLYL)LACTIC ACID;3-[3-INDOLYL]-2-HYDROXYPROPANOIC ACID;DL-3-(3-INDOLYL)-LACTIC ACID;DL-3-INDOLELACTIC ACID;DL-B-3-INDOLELACTIC ACID | | CAS: | 1821-52-9 | | MF: | C11H11NO3 | | MW: | 205.21 | | EINECS: | 217-347-0 | | Product Categories: | Indoles;Simple Indoles | | Mol File: | 1821-52-9.mol |  |
| | DL-INDOLE-3-LACTIC ACID Chemical Properties |
| Melting point | 145-146 °C(lit.) | | Boiling point | 477.3±30.0 °C(Predicted) | | density | 1.428±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.86±0.11(Predicted) | | color | Pale Orange to Pale Purple | | InChI | InChI=1S/C11H11NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,10,12-13H,5H2,(H,14,15) | | InChIKey | XGILAAMKEQUXLS-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(O)CC1C2=C(NC=1)C=CC=C2 | | CAS DataBase Reference | 1821-52-9(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2933.99.9701 |
| | DL-INDOLE-3-LACTIC ACID Usage And Synthesis |
| Uses | DL-Indole-3-lactic Acid is used as a reagent in the synthesis of 2-hydroxy-1-(1H-indol-3-yl)-4-methylpentan-3-one which has weak antibacterial activity against 16 bacterial strains, including Escherichia coli, Bacillus subtilis and Staphylococcus aureus. DL-Indole-3-lactic Acid is also used in the preparation of Monatin, a natural sweet peptidomimetic. | | Definition | ChEBI: A hydroxy monocarboxylic acid that is lactic acid substituted by a 1H-indol-3-yl group at position 3. It is a metabolite of tryptophan. | | in vivo | Indolelactic acid (gavage feeding, 10 μM, 5 μL, 5 days, C57BL/6 mice) benefits the immature intestine preferentially[4].
| Animal Model: | C57BL/6 mice[4] | | Dosage: | 10 μM, 5 μL | | Administration: | Gavage feeding, 5 days | | Result: | Upregulated the innate immune response genes in immature mouse intestine (C57-pup-ileum), with no effects on pup-colon or adult intestine.
|
| | IC 50 | Human Endogenous Metabolite |
| | DL-INDOLE-3-LACTIC ACID Preparation Products And Raw materials |
|