|
|
| | 6-METHYLCHROMONE-2-CARBOXYLIC ACID Basic information |
| | 6-METHYLCHROMONE-2-CARBOXYLIC ACID Chemical Properties |
| Melting point | 267-270 °C (lit.) | | Boiling point | 367.2±42.0 °C(Predicted) | | density | 1.421±0.06 g/cm3(Predicted) | | form | powder to crystal | | pka | 2.40±0.20(Predicted) | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C11H8O4/c1-6-2-3-9-7(4-6)8(12)5-10(15-9)11(13)14/h2-5H,1H3,(H,13,14) | | InChIKey | RKIDLZFIIVDZNX-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)OC2=CC=C(C)C=C2C(=O)C=1 | | CAS DataBase Reference | 5006-44-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 6-METHYLCHROMONE-2-CARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | Almost white crystalline powder | | Uses | 6-Methylchromone-2-carboxylic acid is a chromone derivative. Chromones are cyclic compounds containing nine carbon atoms with sp2 hybridization. They are commonly referred as 1,4-benzapyranes or γ-benzopyrones. Its energy of combustion was measured by an isoperibolic micro-combustion calorimeter. Standard molar enthalpy of formation derived from the energy of combustion, for 6-methylchromone-2-carboxylic acid was reported to be -(656.2 ± 2.2)kJmol-1. | | General Description | 6-Methylchromone-2-carboxylic acid is a chromone derivative. Chromones are cyclic compounds containing nine carbon atoms with sp2 hybridization. They are commonly referred as 1,4-benzapyranes or γ-benzopyrones. Its energy of combustion was measured by an isoperibolic micro-combustion calorimeter. Standard molar enthalpy of formation derived from the energy of combustion, for 6-methylchromone-2-carboxylic acid was reported to be -(656.2 ± 2.2)kJmol-1. |
| | 6-METHYLCHROMONE-2-CARBOXYLIC ACID Preparation Products And Raw materials |
|