- Triisopropoxy(vinyl)silane
-
- $200.00 / 1KG
-
2025-09-25
- CAS:18023-33-1
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | Tri(isopropoxy)vinylsilane Basic information | | Application |
| Product Name: | Tri(isopropoxy)vinylsilane | | Synonyms: | VINYLTRIISOPROPOXYSILANE;VINYLTRISOPROPOXYSILANE;ethenyltris(1-methylethoxy)-silan;1,2,2-tri(propan-2-yloxy)ethenylsilicon;Vinyltriisoprooxysilane;NISTC18023331;ethenyltris(1-methylethoxy)-Silane;Silane, ethenyltris(1-methylethoxy)- | | CAS: | 18023-33-1 | | MF: | C11H24O3Si | | MW: | 232.39 | | EINECS: | 241-931-4 | | Product Categories: | monomer | | Mol File: | 18023-33-1.mol |  |
| | Tri(isopropoxy)vinylsilane Chemical Properties |
| Boiling point | 180 °C | | density | 0.866 | | vapor pressure | 64Pa at 25℃ | | refractive index | n20/D 1.399 | | Fp | 51°C | | storage temp. | 2-8°C, stored under nitrogen | | form | clear liquid | | Specific Gravity | 0.866 | | color | Colorless to Almost colorless | | Water Solubility | 130mg/L at 20℃ | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C11H24O3Si/c1-8-15(12-9(2)3,13-10(4)5)14-11(6)7/h8-11H,1H2,2-7H3 | | InChIKey | MABAWBWRUSBLKQ-UHFFFAOYSA-N | | SMILES | [Si](C=C)(OC(C)C)(OC(C)C)OC(C)C | | LogP | 3.8 at 20℃ | | NIST Chemistry Reference | Silane, (triisopropyloxy)vinyl-(18023-33-1) | | EPA Substance Registry System | Silane, ethenyltris(1-methylethoxy)- (18023-33-1) |
| Risk Statements | 10 | | Safety Statements | 23-24/25 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HS Code | 2931.90.9010 |
| | Tri(isopropoxy)vinylsilane Usage And Synthesis |
| Application | wear-resistant coating: its raw materials, by weight, include: 20-30 parts vinyltriisopropoxysilane, 3-5 parts silica aerogel, 15-20 parts trioxane, 5-9 parts water, 3-7 parts acetic anhydride, 10-15 parts acetylcholine, 0.1-0.3 parts polyoxyethylene dehydrated sorbitol monoglyceride, 10-15 parts crystalline silica, and 7-13 parts graphite powder; wherein the porosity of the silica aerogel is 75-79%, and the weight ratio of silica aerogel to vinyltriisopropoxysilane is 1:(5-7). By adding vinyltriisopropoxysilane, a large amount of SiOH is formed after hydrolysis. Following dehydration, a highly cross-linked, silica-like hard network is formed, exhibiting good wear resistance. Simultaneously, the presence of directly bonded organic groups significantly increases the coating's flexibility, reduces stress cracking, and improves the adhesion strength between the coating and the substrate. Adding silica aerogel and properly controlling its porosity can increase the coating's viscosity, resulting in a thicker film. Furthermore, the inorganic nature of the added sol increases the film's wear resistance. By appropriately controlling the ratio of silica aerogel to vinyltriisopropoxysilane within a certain range, the paint's abrasion resistance can be significantly increased. Using trioxane as a solvent not only increases the coating's leveling and surface uniformity but also forms a network with the substrate surface. The inter-layer enhances adhesion to the substrate. By adding water and mixing with trioxane, the amount of trioxane used can be reduced, thus lowering costs. Using acetic anhydride as a hydrolysis catalyst ensures the overall paint system remains weakly acidic. Acetylcholine effectively lowers the coating's curing temperature, meeting the requirements for optical plastics with low heat distortion temperatures. By controlling the ratio of acetic anhydride and acetylcholine, the curing time can be shortened, reducing curing energy consumption and costs, increasing the coating's crosslinking degree, and enhancing its scratch resistance. Polyoxyethylene dehydrated sorbitol monoglyceride is used as a leveling agent, also acting as a lubricant, reducing the coating's coefficient of friction and significantly increasing its scratch resistance. Crystalline silica and graphite powder exhibit good abrasion resistance; by controlling their ratio, the paint's abrasion resistance is greatly increased. | | Flammability and Explosibility | Flammable |
| | Tri(isopropoxy)vinylsilane Preparation Products And Raw materials |
|