|
|
| | 1,3-Cyclohexanedicarboxylic acid Basic information |
| Product Name: | 1,3-Cyclohexanedicarboxylic acid | | Synonyms: | 1,3-CYCLOHEXANEDICARBOXYLIC ACID;1,3-cyclohexanedicarboxylicacid,mixtureof;1,3-Cyclohexanedicarboxylic acid,mixture of cis and trans;1,3-CYCLOHEXANEDICARBOXYLIC ACID, 98%, M IXTURE OF CIS AND TRANS;CYCLOHEXANE-1,3-DICARBOXYLIC ACID;1,3-cyclohexanedicarboxylic;1,3-Cyclohexanedicarboxylic Acid (cis- and trans- mixture);1,3-Cyclohexanedicarboxylic acid, Mixture of cis and trans 98% | | CAS: | 3971-31-1 | | MF: | C8H12O4 | | MW: | 172.18 | | EINECS: | 432-490-0 | | Product Categories: | Carboxylic Acid Monomers;Monomers;Polymer Science;3971-31-1 | | Mol File: | 3971-31-1.mol |  |
| | 1,3-Cyclohexanedicarboxylic acid Chemical Properties |
| Melting point | 132-141 °C(lit.) | | Boiling point | 332.4±25.0 °C(Predicted) | | density | 1.314±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 4.32±0.13(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C8H12O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12) | | InChIKey | XBZSBBLNHFMTEB-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)CCCC(C(O)=O)C1 | | CAS DataBase Reference | 3971-31-1(CAS DataBase Reference) | | EPA Substance Registry System | 1,3-Cyclohexanedicarboxylic acid (3971-31-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-41 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29172090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,3-Cyclohexanedicarboxylic acid Usage And Synthesis |
| Uses | 1,3-Cyclohexanedicarboxylic acid can be used in the synthesis of organic materials and liquid crystal materials.
| | Synthesis | 1. To a methanol (2.8 L) suspension containing isophthalic acid (500 g, 3 mol), 5% rhodium/alumina catalyst (50 g) and acetic acid (150 mL) were added sequentially. 2. The reaction mixture was subjected to a hydrogen atmosphere (50 psi) and shaken overnight at room temperature. 3. Upon completion of the reaction, the mixture was filtered through a diatomaceous earth pad to remove the catalyst. 4. Fresh 5% rhodium/alumina catalyst (25 g) was added to the filtrate. Fresh 5% rhodium/alumina catalyst (25 g) was added to the filtrate and the reaction was again shaken under hydrogen atmosphere (50 psi) for 24 h. 5. At the end of the reaction, the final reaction mixture was filtered through a pad of diatomaceous earth. 6. The filtrate was concentrated under reduced pressure to give 493 g of 1,3-cyclohexanedicarboxylic acid as white powder in 96.3% yield. 7. The product has a melting point of 163-165 °C. The melting point of the product was 163-165°C. | | References | [1] Patent: US2003/100576, 2003, A1 [2] Patent: US2004/10005, 2004, A1. Location in patent: Page 18 [3] Patent: JP2004/509897, 2004, A. Location in patent: Page 45 [4] Patent: US2004/10005, 2004, A1. Location in patent: Page 22 |
| | 1,3-Cyclohexanedicarboxylic acid Preparation Products And Raw materials |
|