|
|
| | (R)-2-(Aminomethyl)-1-N-Boc-pyyrolidine Basic information |
| Product Name: | (R)-2-(Aminomethyl)-1-N-Boc-pyyrolidine | | Synonyms: | (R)-2-(AMINOMETHYL)-1-N-BOC-PYRROLIDINE;(r)-2-(aminomethyl)-1-n-boc-pyyrolidine;(R)-2-(AMINOMETHYL)-1-BOC-PYRROLIDINE;(R)-TERT-BUTYL-2-(AMINOMETHYL)PYRROLIDINE-1-CARBOXYLATE;R-1-N-BOC-2-AMINOMETHYL PYRROLIDINE;(R)-N’-BOC-2-aminomethylpirrolidine;N1-BOC-(R)-2-(AMINOMETHYL)PYRROLIDINE;(R)-2-(Aminomethyl)pyrrolidine, N1-BOC protected | | CAS: | 259537-92-3 | | MF: | C10H20N2O2 | | MW: | 200.28 | | EINECS: | | | Product Categories: | Pyrrole&Pyrrolidine&Pyrroline | | Mol File: | 259537-92-3.mol |  |
| | (R)-2-(Aminomethyl)-1-N-Boc-pyyrolidine Chemical Properties |
| Boiling point | 98-110℃/1mm | | density | 1.044±0.06 g/cm3(Predicted) | | refractive index | 1.4680 to 1.4720 | | storage temp. | 2-8°C | | form | clear liquid | | pka | 9.91±0.29(Predicted) | | color | Colorless to Almost colorless | | Optical Rotation | [α]/D +47.0±2°, c = 1 in chloroform | | Water Solubility | Slightly soluble in water. | | BRN | 8905234 | | InChI | 1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-5-8(12)7-11/h8H,4-7,11H2,1-3H3/t8-/m1/s1 | | InChIKey | SOGXYCNKQQJEED-MRVPVSSYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CN | | CAS DataBase Reference | 259537-92-3(CAS DataBase Reference) |
| Hazard Codes | Xi,N,C | | Risk Statements | 36/37/38-51/53-34-22 | | Safety Statements | 26-36/37/39-61-45 | | RIDADR | UN 2735PSN1 8 / PGIII | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29339900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Skin Corr. 1B |
| | (R)-2-(Aminomethyl)-1-N-Boc-pyyrolidine Usage And Synthesis |
| Uses | Reactant in the synthesis of diamino derivatives of [1, 2, 4] triazolo [1, 5-a][1, 3, 5] triazine(potent and selective adenosine A2A receptor antagonists). |
| | (R)-2-(Aminomethyl)-1-N-Boc-pyyrolidine Preparation Products And Raw materials |
|