|
|
| | 4-Hydroxy-2-methoxybenzaldehyde Basic information |
| | 4-Hydroxy-2-methoxybenzaldehyde Chemical Properties |
| Melting point | 158-161 °C | | Boiling point | 234.6°C (rough estimate) | | density | 1.2143 (rough estimate) | | refractive index | 1.4447 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 7.40±0.18(Predicted) | | form | Powder | | color | Off-white to light brown | | Water Solubility | practically insoluble | | Sensitive | Air Sensitive | | BRN | 2045122 | | Cosmetics Ingredients Functions | HAIR DYEING | | InChI | 1S/C8H8O3/c1-11-8-4-7(10)3-2-6(8)5-9/h2-5,10H,1H3 | | InChIKey | WBIZZNFQJPOKDK-UHFFFAOYSA-N | | SMILES | OC1=CC(OC)=C(C([H])=O)C=C1 | | LogP | 1.781 (est) | | CAS DataBase Reference | 18278-34-7(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Hydroxy-2-methoxybenaldehyde(18278-34-7) |
| | 4-Hydroxy-2-methoxybenzaldehyde Usage And Synthesis |
| Chemical Properties | 4-Hydroxy-2-methoxybenzaldehyde is off-white to greenish or light brown cryst. powder | | Uses | A useful intermediate in the sythesis of solid phase supports for the preparation of fully protected peptide fragments. | | Uses | 4-Hydroxy-2-methoxybenzaldehyde is a useful intermediate in the sythesis of solid phase supports for the preparation of fully protected peptide fragments | | Hazard | 4-Hydroxy-2-methoxybenzaldehyde is irritating to skin and eyes and may cause respiratory irritation. It is harmful to aquatic organisms and has long-term effects. | | reaction suitability | reagent type: cross-linking reagent
reagent type: linker |
| | 4-Hydroxy-2-methoxybenzaldehyde Preparation Products And Raw materials |
|