|
|
| | 6-CHLORO-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZINE Basic information | | Uses |
| Product Name: | 6-CHLORO-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZINE | | Synonyms: | 1,2,4-TRIAZOLO[4,3-B]PYRIDAZINE, 6-CHLORO-;AKOS BBS-00002547;6-CHLORO-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZINE;6-Chloro[1,2,4]Triazolo[4,3-b];1,2,4-Triazolo[4,3-b]pyridazine,6-chloro- (CAS No.28593-24-0);6--1,2,4- three[4,3-B]chlorinepyrazolopyridazine;6-chloro-[1,2,4]triazolo[3,4-f]pyridazine;s-Triazolo[4,3-b]pyridazine, 6-chloro- | | CAS: | 28593-24-0 | | MF: | C5H3ClN4 | | MW: | 154.56 | | EINECS: | | | Product Categories: | Imidazo[x,x-y]pyridazine;Building Blocks;Fused Ring Systems;Halides | | Mol File: | 28593-24-0.mol | ![6-CHLORO-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZINE Structure](CAS/GIF/28593-24-0.gif) |
| | 6-CHLORO-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZINE Chemical Properties |
| Melting point | 203-204 °C | | density | 1.71±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | -0.73±0.30(Predicted) | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C5H3ClN4/c6-4-1-2-5-8-7-3-10(5)9-4/h1-3H | | InChIKey | OUNXXBYNOUBNPF-UHFFFAOYSA-N | | SMILES | C12=NN=CN1N=C(Cl)C=C2 | | CAS DataBase Reference | 28593-24-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 6-CHLORO-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZINE Usage And Synthesis |
| Uses | 6-Chloro-1,2,4-triazolo[4,3-B]pyridazine is a heterocyclic organic compound that can be used as a pharmaceutical intermediate. | | Synthesis | The reaction was carried out in isopropanol (10 mL) at reflux for 3 hours with 3-chloro-6-hydrazinopyridazine (1.0 g, 7.0 mmol) and compound (CAS: 243116-57-6, 1.5 g, 7.0 mmol). After completion of the reaction, it was cooled to room temperature and the resulting precipitate was collected by filtration. The resulting solid was recrystallized with dichloromethane to afford 6-chloro-1,2,4-triazolo[4,3-B]pyridazine as a white solid (720 mg, 71% yield). | | References | [1] Patent: WO2008/69500, 2008, A1. Location in patent: Page/Page column 9-10; 24 |
| | 6-CHLORO-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZINE Preparation Products And Raw materials |
|