| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Baran TFCS-Na Reagent Basic information |
| Product Name: | Baran TFCS-Na Reagent | | Synonyms: | Baran TFCS-Na Reagent;Sodium 1-(trifluoromethyl)cyclopropanesulfinate;1-(trifluoromethyl)cyclopropane-1-sulfinic acid sodium;1-(Trifluoromethyl)cyclopropane-1-sulfinate (sodium) | | CAS: | 1622292-60-7 | | MF: | C4H6F3NaO2S | | MW: | 198.13 | | EINECS: | | | Product Categories: | | | Mol File: | 1622292-60-7.mol |  |
| | Baran TFCS-Na Reagent Chemical Properties |
| Melting point | 287-292 °C | | form | solid | | InChI | InChI=1S/C4H5F3O2S.Na.H/c5-4(6,7)3(1-2-3)10(8)9;;/h1-2H2,(H,8,9);; | | InChIKey | FDZSYKYMWJRYNH-UHFFFAOYSA-N | | SMILES | C(C1(CC1)S(O)=O)(F)(F)F.[NaH] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Baran TFCS-Na Reagent Usage And Synthesis |
| Uses | Sodium 1-(Trifluoromethyl)cyclopropanesulfinate acts as a reagent for the preparation of sulfinate salts from carboxylic acids and mercaptopyridine N-oxide via Barton reaction and ruthenium-catalyzed oxidation for C-H functionalization of heterocycles. | | reaction suitability | reaction type: C-C Bond Formation
reagent type: catalyst
reaction type: C-H Activation |
| | Baran TFCS-Na Reagent Preparation Products And Raw materials |
|