- FMOC-DOPA(ACETONIDE)-OH
-
- $0.00 / 100mg
-
2025-09-18
- CAS:852288-18-7
- Min. Order: 100mg
- Purity: 97%
- Supply Ability: 10000
|
| | FMOC-DOPA(ACETONIDE)-OH Basic information |
| Product Name: | FMOC-DOPA(ACETONIDE)-OH | | Synonyms: | FMOC-DOPA(ACETONIDE)-OH;(S)-2-(((9H-fluoren-9-yl)methyl9H-fluoren-9-yl)methoxy)carbonylamino)-3-(2,2-dimethylbenzo[d][1,3]dioxol-5-yl)propanoic acid;REF DUPL: Fmoc-DOPA(acetonide)-OH;Fmoc-POPA(acetonide)-OH;(S)-2-((((9H-Fluoren-9-yl)Methoxy)carbonyl)aMino)-3-(2,2-diMethylbenzo[d][1,3]dioxol-5-yl)propanoic acid;Fmoc-3,4-dihydroxy-L-phenylalanine, acetonide protected≥ 98% (HPLC);Fmoc-DOPA-OH, acetonide protected;(9H-Fluoren-9-yl)MethOxy]Carbonyl Dopa(Acetonide)-OH | | CAS: | 852288-18-7 | | MF: | C27H25NO6 | | MW: | 459.49 | | EINECS: | | | Product Categories: | | | Mol File: | 852288-18-7.mol |  |
| | FMOC-DOPA(ACETONIDE)-OH Chemical Properties |
| Boiling point | 663.1±55.0 °C(Predicted) | | density | 1.301 | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | form | powder | | pka | 3.68±0.10(Predicted) | | Appearance | White to yellow Solid | | Major Application | peptide synthesis | | InChIKey | SHZLOTJPHMTVDI-ZEGQKUPANA-N | | SMILES | C1(COC(=O)N[C@@H](CC2C=CC3=C(C=2)OC(O3)(C)C)C(O)=O)C2C=CC=CC=2C2C=CC=CC1=2 |&1:6,r| |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | FMOC-DOPA(ACETONIDE)-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-DOPA(ACETONIDE)-OH Preparation Products And Raw materials |
| Raw materials | L-Tyrosine, 3-hydroxy-N-(2,2,2-trifluoroacetyl)-, methyl ester-->1,3-Benzodioxole-5-propanoic acid, α-amino-2,2-dimethyl-, methyl ester, (αS)--->FMOC-3,4-DIHYDROXY-L-PHENYLALANINE-->Levodopa-->Fmoc-OSu-->2,2-Dimethoxypropane |
|