| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
- 4-Amino-m-terphenyl
-
-
2026-01-20
- CAS:63344-48-9
- Min. Order: 25kg
- Purity: 99.9%
- Supply Ability: 100kg
- 4-Amino-m-terphenyl
-
- $35.00
-
2023-11-13
- CAS:63344-48-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20 Ton
|
| | 4-Amino-m-terphenyl Basic information |
| Product Name: | 4-Amino-m-terphenyl | | Synonyms: | 4-Amino-m-terphenyl;2,4-diphenylaniline;1,1':3',1''-Terphenyl]-4'-amine;[1,1':3',1'-tribiphenyl]-4'-amine | | CAS: | 63344-48-9 | | MF: | C18H15N | | MW: | 245.32 | | EINECS: | | | Product Categories: | | | Mol File: | 63344-48-9.mol |  |
| | 4-Amino-m-terphenyl Chemical Properties |
| Melting point | 67-68 °C | | Boiling point | 398.2±11.0 °C(Predicted) | | density | 1.103±0.06 g/cm3(Predicted) | | pka | 3.48±0.10(Predicted) | | InChI | InChI=1S/C18H15N/c19-18-12-11-16(14-7-3-1-4-8-14)13-17(18)15-9-5-2-6-10-15/h1-13H,19H2 | | InChIKey | JZKJBFCCYSJAQX-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(N)C(C3=CC=CC=C3)=C2)=CC=CC=C1 |
| | 4-Amino-m-terphenyl Usage And Synthesis |
| | 4-Amino-m-terphenyl Preparation Products And Raw materials |
|