|
|
| | piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate Basic information | | Physical Form |
| Product Name: | piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate | | Synonyms: | piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate;piperidin-4-yl N-(2-phenylphenyl)carbamate;Carbamic acid, N-[1,1'-biphenyl]-2-yl-, 4-piperidinyl ester-;16403-A2 ,9291;4-PIPERIDYL N-(2-BIPHENYL)CARBAMATE;piperidin-4-yl biphenyl-2-ylcarbamate;N-[1,1'-biphenyl]-2-yl,4-piperidinyl ester (BPC-H);piperidin-4-yl N-(2-phenyphenyl)carbamate | | CAS: | 171722-92-2 | | MF: | C18H20N2O2 | | MW: | 296.36 | | EINECS: | 605-615-3 | | Product Categories: | ADVANCED INT. | | Mol File: | 171722-92-2.mol | ![piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate Structure](CAS/20180702/GIF/171722-92-2.gif) |
| | piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate Chemical Properties |
| Boiling point | 427.1±45.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 13.34±0.70(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C18H20N2O2/c21-18(22-15-10-12-19-13-11-15)20-17-9-5-4-8-16(17)14-6-2-1-3-7-14/h1-9,15,19H,10-13H2,(H,20,21) | | InChIKey | AGZCCVMWUZINGV-UHFFFAOYSA-N | | SMILES | C(OC1CCNCC1)(=O)NC1=CC=CC=C1C1=CC=CC=C1 |
| | piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate Usage And Synthesis |
| Physical Form | Solid | | Uses | 4-Piperidyl N-(2-biphenylyl)carbamate is an intermediate in the synthesis of Des-4''(methylpiperidine-4-carboxamide)-4''-hydroxymethyl Revefenacin (D119860), an impurity of Revefenacin (R279600). Revefenacin is a pharmaceutical drug for the treatment of chronic obstructive pulmonary diseases. |
| | piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate Preparation Products And Raw materials |
|