|
|
| | H-ASP-ASP-OH Basic information |
| | H-ASP-ASP-OH Chemical Properties |
| Boiling point | 587.7±50.0 °C(Predicted) | | density | 1.602±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | pka | 2.77±0.10(Predicted) | | Sequence | Asp-Asp | | InChI | InChI=1/C8H12N2O7/c9-3(1-5(11)12)7(15)10-4(8(16)17)2-6(13)14/h3-4H,1-2,9H2,(H,10,15)(H,11,12)(H,13,14)(H,16,17)/t3-,4-/s3 | | InChIKey | FRYULLIZUDQONW-APQYWOSTNA-N | | SMILES | [C@@H](C(=O)O)(CC(=O)O)NC(=O)[C@@H](N)CC(=O)O |&1:0,11,r| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 |
| | H-ASP-ASP-OH Usage And Synthesis |
| Definition | ChEBI: Asp-Asp is a dipeptide formed from two L-aspartic acid units. It has a role as a Mycoplasma genitalium metabolite. It is functionally related to a L-aspartic acid. |
| | H-ASP-ASP-OH Preparation Products And Raw materials |
|