| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | Methyl 3-bromo-2-(bromomethyl)-4,5-dimethoxybenzoate Basic information |
| | Methyl 3-bromo-2-(bromomethyl)-4,5-dimethoxybenzoate Chemical Properties |
| Melting point | 126 °C | | Boiling point | 414.5±45.0 °C(Predicted) | | density | 1.665±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | InChI | InChI=1S/C11H12Br2O4/c1-15-8-4-6(11(14)17-3)7(5-12)9(13)10(8)16-2/h4H,5H2,1-3H3 | | InChIKey | GQHPLAGWOKBJEH-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(OC)=C(OC)C(Br)=C1CBr |
| | Methyl 3-bromo-2-(bromomethyl)-4,5-dimethoxybenzoate Usage And Synthesis |
| | Methyl 3-bromo-2-(bromomethyl)-4,5-dimethoxybenzoate Preparation Products And Raw materials |
|