| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
ChemShuttle, Inc. |
| Tel: |
0510-83588313-811 18800520310 |
| Email: |
sales@chemshuttle.com |
5,6-dimethoxybenzo[b]thiophene manufacturers
|
| | 5,6-dimethoxybenzo[b]thiophene Basic information |
| | 5,6-dimethoxybenzo[b]thiophene Chemical Properties |
| Melting point | 89-91 °C | | Boiling point | 295.6±20.0 °C(Predicted) | | density | 1.206±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H10O2S/c1-11-8-5-7-3-4-13-10(7)6-9(8)12-2/h3-6H,1-2H3 | | InChIKey | KLQSAAONLQIKDE-UHFFFAOYSA-N | | SMILES | C12=CC(OC)=C(OC)C=C1C=CS2 |
| | 5,6-dimethoxybenzo[b]thiophene Usage And Synthesis |
| | 5,6-dimethoxybenzo[b]thiophene Preparation Products And Raw materials |
|