1,1-DIMETHOXY-4-DIMETHYLAMINOBUT-3-EN-2-ONE manufacturers
|
| | 1,1-DIMETHOXY-4-DIMETHYLAMINOBUT-3-EN-2-ONE Basic information |
| Product Name: | 1,1-DIMETHOXY-4-DIMETHYLAMINOBUT-3-EN-2-ONE | | Synonyms: | BUTTPARK 43\57-38;1,1-DIMETHOXY-4-DIMETHYLAMINOBUT-3-EN-2-ONE;4-(DIMETHYLAMINO)-1,1-DIMETHOXYBUT-3-EN-2-ONE;4-(Dimethylamino)-1,1-dimethoxybut-3-en-2-one, 95+%;[(1E)-4,4-Dimethoxy-3-oxobut-1-en-1-yl]dimethylamine;E-1,1-Dimethoxy-4-dimethylaminobut-3-en-2-one;1,1-DiMethoxyI-4-diMethylaMinobut-3-en-2-one;4-Dimethylamino-1,1-dimethoxy-3-butene-2-one | | CAS: | 67751-23-9 | | MF: | C8H15NO3 | | MW: | 173.21 | | EINECS: | | | Product Categories: | | | Mol File: | 67751-23-9.mol |  |
| | 1,1-DIMETHOXY-4-DIMETHYLAMINOBUT-3-EN-2-ONE Chemical Properties |
| Boiling point | 110 °C | | density | 1.008g/ml | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | liquid | | pka | 6.42±0.70(Predicted) | | color | Dark brown | | InChI | InChI=1S/C8H15NO3/c1-9(2)6-5-7(10)8(11-3)12-4/h5-6,8H,1-4H3 | | InChIKey | DFZIBCAWOSFLFR-UHFFFAOYSA-N | | SMILES | C(OC)(OC)C(=O)C=CN(C)C |
| | 1,1-DIMETHOXY-4-DIMETHYLAMINOBUT-3-EN-2-ONE Usage And Synthesis |
| Uses | 4-Dimethylamino-1,1-dimethoxybut-3-en-2-one is used in the preparation of substituted anthranilic amide derivatives as VEGF modulators against cancer and other disorders. | | Synthesis | The general procedure for the synthesis of 4-(dimethylamino)-1,1-dimethoxy-3-buten-2-one from 1,1-dimethoxyacetone and N,N-dimethylformamide dimethyl acetal was as follows: 1,1-dimethoxy-N,N-dimethylformamide (100 g, 839 mmol, 1.02 equiv.) was mixed with 1,1-dimethoxyacetone (97 g, 821 mmol) were mixed and the reaction was stirred at 110 °C for 3 hours. The methanol generated was removed during the reaction via a Dean-Stark device. Upon completion of the reaction, the reaction solution was cooled to room temperature and the remaining volatiles were subsequently removed under vacuum to afford the crude product (E)-4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one (130 g, theoretical yield 143 g, 91% yield). The product was analyzed by LC-MS, m/z 283 (M + 1). Ref: WO 2006/0097341A1 (incorporated by reference), p. 67. | | References | [1] Patent: US2012/270892, 2012, A1. Location in patent: Page/Page column 56
[2] Patent: WO2013/2660, 2013, A2. Location in patent: Paragraph 00145; 00146
[3] Tetrahedron, 2008, vol. 64, # 33, p. 7745 - 7758
[4] Patent: WO2004/22553, 2004, A1. Location in patent: Page/Page column 18
[5] Patent: US2011/98272, 2011, A1. Location in patent: Page/Page column 22 |
| | 1,1-DIMETHOXY-4-DIMETHYLAMINOBUT-3-EN-2-ONE Preparation Products And Raw materials |
|