| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | Ac-Leu-Glu-Val-Asp-aldehyde (pseudo acid) Basic information |
| | Ac-Leu-Glu-Val-Asp-aldehyde (pseudo acid) Chemical Properties |
| Boiling point | 914.6±65.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | storage temp. | Store at 0°C | | solubility | water: 1 mg/mL | | pka | 4.19±0.10(Predicted) | | form | lyophilized solid | | color | white | | Water Solubility | water: 1mg/mL | | Sequence | Ac-Leu-Glu-Val-Asp-CHO | | InChIKey | MXGJLIBJKIIQSF-FPXQBCRKSA-N | | SMILES | N([C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C=O)C(=O)[C@@H](NC(=O)[C@@H](NC(=O)C)CC(C)C)CCC(=O)O |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | Ac-Leu-Glu-Val-Asp-aldehyde (pseudo acid) Usage And Synthesis |
| Uses | Ac-LEVD-CHO is a caspase-4 inhibitor. Ac-LEVD-CHO is a peptide with the sequence of Ac-Leu-Glu-Val-Asp-al[1]. | | Biological Activity | Cell permeable: no', 'Primary Target
caspase-4', 'Product does not compete with ATP.', 'Reversible: yes | | IC 50 | Caspase-4 | | References | [1] Hye-Kyoung Jun, et al. Treponema denticola, Porphyromonas gingivalis, and Tannerella forsythia induce cell death and release of endogenous danger signals. Arch Oral Biol. 2017, 72, 73. DOI:10.1016/j.archoralbio.2016.09.010 |
| | Ac-Leu-Glu-Val-Asp-aldehyde (pseudo acid) Preparation Products And Raw materials |
|