|
|
| | Fmoc-4-Amino-L-phenylalanine Basic information |
| | Fmoc-4-Amino-L-phenylalanine Chemical Properties |
| Boiling point | 671.5±55.0 °C(Predicted) | | density | 1.316±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.63±0.10(Predicted) | | form | Powder | | color | White to light yellow | | InChIKey | VALNSJHHRPSUDO-QFIPXVFZSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(N)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 95753-56-3(CAS DataBase Reference) |
| HazardClass | IRRITANT | | HS Code | 2922498590 |
| | Fmoc-4-Amino-L-phenylalanine Usage And Synthesis |
| Chemical Properties | Off-white to light yellow powder | | Uses | Fmoc-Phe(4-NH2)-OH is a phenylalanine derivative[1]. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-834. DOI:10.1080/10408398.2012.708368 |
| | Fmoc-4-Amino-L-phenylalanine Preparation Products And Raw materials |
|