| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:L-Serine -13C3,15N CAS:202407-34-9 Package:2.5Mg,25Mg
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:L-Serine-13C3,15N CAS:202407-34-9 Purity:98 atom % 15N, 98 atom % 13C, 95% (CP) Package:250MG Remarks:608130-250MG
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:L-Serine -13C3,15N CAS:202407-34-9 Purity:>=99 atom% 13C,>=99 atom% 15N,>=98% Package:5mg Remarks:B72738
|
|
| | L-SERINE-13C3, 15N Basic information |
| Product Name: | L-SERINE-13C3, 15N | | Synonyms: | L-SERINE-13C3, 15N;L-SERINE (U-13C3, 15N);L-Serine-ul-13C,15N;[13C3,15N]-L-Serine;L-Serine-13C?,1?N;L-Serine-13C3,15N;L-Ser-3-13C-15N | | CAS: | 202407-34-9 | | MF: | C3H7NO3 | | MW: | 109.13 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | L-SERINE-13C3, 15N Chemical Properties |
| Melting point | 222 °C (dec. )(lit.) | | storage temp. | Refrigerator | | solubility | Aqueous Base (Slightly), Water (Sparingly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D +14.6°, c = 2 in 1 M HCl | | InChI | 1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1/i1+1,2+1,3+1,4+1 | | InChIKey | MTCFGRXMJLQNBG-UVYXLFMMSA-N | | SMILES | [15NH2][13C@@H]([13CH2]O)[13C](O)=O | | CAS Number Unlabeled | 56-45-1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-SERINE-13C3, 15N Usage And Synthesis |
| Uses | Isotope labelled L-Serine is used in the synthesis of purines and pyrimidines as antibacterial/antifungal agents, as well as acting as a proteinogenic compound. |
| | L-SERINE-13C3, 15N Preparation Products And Raw materials |
|