|
|
| | 4,5-bis(4-dimethylaminophenyl)-2-(3,5-dimethoxy-4-hydroxyphenyl)imidazole Basic information |
| | 4,5-bis(4-dimethylaminophenyl)-2-(3,5-dimethoxy-4-hydroxyphenyl)imidazole Chemical Properties |
| Melting point | 262-263 °C | | Boiling point | 684.0±55.0 °C(Predicted) | | density | 1.209±0.06 g/cm3(Predicted) | | pka | 9.29±0.25(Predicted) | | InChI | InChI=1S/C27H30N4O3/c1-30(2)20-11-7-17(8-12-20)24-25(18-9-13-21(14-10-18)31(3)4)29-27(28-24)19-15-22(33-5)26(32)23(16-19)34-6/h7-16,32H,1-6H3,(H,28,29) | | InChIKey | SZXKSDXHODZTFS-UHFFFAOYSA-N | | SMILES | C1(O)=C(OC)C=C(C2NC(C3=CC=C(N(C)C)C=C3)=C(C3=CC=C(N(C)C)C=C3)N=2)C=C1OC |
| | 4,5-bis(4-dimethylaminophenyl)-2-(3,5-dimethoxy-4-hydroxyphenyl)imidazole Usage And Synthesis |
| Uses | Photosensitizer-1 (Compound CLB-13) is a photosensitizer[1]. | | References | [1] Shigeto Goto, et al. Silver salt photothermographic dry imaging material and image forming method. JP2006350000A. |
| | 4,5-bis(4-dimethylaminophenyl)-2-(3,5-dimethoxy-4-hydroxyphenyl)imidazole Preparation Products And Raw materials |
|