| Company Name: |
Bide Pharmatech Ltd. Gold |
| Tel: |
400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
tert-Butyl-DCL (PSMA inhibitor) manufacturers
- CS-0047390
-
- $29.00
-
2026-07-15
- CAS:1025796-31-9
- Purity: 98.00%
- Supply Ability: 10g
|
| | tert-Butyl-DCL (PSMA inhibitor) Basic information |
| Product Name: | tert-Butyl-DCL (PSMA inhibitor) | | Synonyms: | (S)?-?DI-?TERT-?BUTYL 2-?(3-?((S)?-?6-?AMINO-?1-?(TERT-?BUTOXY)?-?1-?OXOHEXAN-?2-?YL)?UREIDO)?PENTANEDIOATE; MIN. 96?%, MIN;min. 96%, min;(S)-Di-Tert-Butyl 2-(3-((S)-6-Amino-1-(Tert-Butoxy)-1-Oxohexan-2-Yl)Ureido)Pentanedioate(WXC02272);L-Glutamic acid, N-[[[(1S)-5-amino-1-[(1,1-dimethylethoxy)carbonyl]pentyl]amino]carbonyl]-, 1,5-bis(1,1-dimethylethyl) ester;tert-Butyl-DCL (PSMA inhibitor);ditert-butyl (2S)-2-[[(2S)-6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate;N-[(S)-5-Amino-1-(tert-butoxycarbonyl)pentyl-carbamoyl]-L-glutamic acid bis tert-butyl ester;CS 0047390,CS0047390 | | CAS: | 1025796-31-9 | | MF: | C24H45N3O7 | | MW: | 487.63 | | EINECS: | | | Product Categories: | | | Mol File: | 1025796-31-9.mol |  |
| | tert-Butyl-DCL (PSMA inhibitor) Chemical Properties |
| Boiling point | 596.6±50.0 °C(Predicted) | | density | 1.072±0.06 g/cm3(Predicted) | | solubility | Water: Soluble | | form | Solid-Liquid Mixture | | pka | 12.09±0.46(Predicted) | | color | Colorless to off-white | | InChIKey | IXWXFSGSTGXUFO-IRXDYDNUSA-N | | SMILES | C(OC(C)(C)C)(=O)[C@H](CCC(OC(C)(C)C)=O)NC(N[C@H](C(OC(C)(C)C)=O)CCCCN)=O |
| | tert-Butyl-DCL (PSMA inhibitor) Usage And Synthesis |
| Chemical Properties | Appearance: White powder
Purity (HPLC): ≥98.0%
Acetate content ≤12.0%
Water content ≤8.0%
Peptide content ≥80.0%
Endotoxin ≤50EU/mg
Amino acid composition analysis ≤±10% | | Uses | (S)-Di-tert-butyl 2-(3-((S)-6-Amino-1-(tert-butoxy)-1-oxohexan-2-yl)ureido)pentanedioate is used as a reactant in the synthesis of novel multivalent fluorescent inhibitors with high affinity to prostate cancer. | | References | [1] JOANA F. SANTOS, ANTÓNIO PAULO* Synthesis and Preclinical Evaluation of PSMA-Targeted 111In-Radioconjugates Containing a Mitochondria-Tropic Triphenylphosphonium Carrier[J]. Molecular Pharmaceutics, 2023, 21 1: 216-233. DOI: 10.1021/acs.molpharmaceut.3c00787 |
| | tert-Butyl-DCL (PSMA inhibitor) Preparation Products And Raw materials |
|