16-(Benzyloxy)-16-Oxohexadecanoic Acid manufacturers
|
| | 16-(Benzyloxy)-16-Oxohexadecanoic Acid Basic information |
| Product Name: | 16-(Benzyloxy)-16-Oxohexadecanoic Acid | | Synonyms: | 16-(Benzyloxy)-16-Oxohexadecanoic Acid;Hexadecanedioic acid, 1-(phenylmethyl) ester;16-Oxo-16-Phenylmethoxyhexadecanoic Acid;hexadecanedioic Acid Monobenzyl Ester;Hexadecanedioic acid, mono(phenylmethyl) ester | | CAS: | 146004-98-0 | | MF: | C23H36O4 | | MW: | 376.53 | | EINECS: | | | Product Categories: | | | Mol File: | 146004-98-0.mol |  |
| | 16-(Benzyloxy)-16-Oxohexadecanoic Acid Chemical Properties |
| Boiling point | 505.8±23.0 °C(Predicted) | | density | 1.023±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.78±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C23H36O4/c24-22(25)18-14-9-7-5-3-1-2-4-6-8-10-15-19-23(26)27-20-21-16-12-11-13-17-21/h11-13,16-17H,1-10,14-15,18-20H2,(H,24,25) | | InChIKey | RKIWVFNLOSNCET-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)CCCCCCCCCCCCCCC(O)=O |
| | 16-(Benzyloxy)-16-Oxohexadecanoic Acid Usage And Synthesis |
| | 16-(Benzyloxy)-16-Oxohexadecanoic Acid Preparation Products And Raw materials |
|