4-Bromo-3-bromomethyl-benzoic acid ethyl ester manufacturers
|
| | 4-Bromo-3-bromomethyl-benzoic acid ethyl ester Basic information |
| | 4-Bromo-3-bromomethyl-benzoic acid ethyl ester Chemical Properties |
| Boiling point | 368.7±32.0 °C(Predicted) | | density | 1.699±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C10H10Br2O2/c1-2-14-10(13)7-3-4-9(12)8(5-7)6-11/h3-5H,2,6H2,1H3 | | InChIKey | BMPAWOLCRAJVPC-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C1=CC=C(Br)C(CBr)=C1 |
| | 4-Bromo-3-bromomethyl-benzoic acid ethyl ester Usage And Synthesis |
| Uses | 4-Bromo-3-bromomethylbenzoic acid ethyl ester is a synthetic intermediate used in the preparation of aromatic-containing biological agents for the treatment of diabetes, kidney disease or hypertension. |
| | 4-Bromo-3-bromomethyl-benzoic acid ethyl ester Preparation Products And Raw materials |
|