| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 3,6-dibromo-4,5-difluoro-1,2-phenylenediamine Basic information |
| Product Name: | 3,6-dibromo-4,5-difluoro-1,2-phenylenediamine | | Synonyms: | 3,6-dibromo-4,5-difluoro-1,2-phenylenediamine;3,6-Dibromo-4,5-difluoro-1,2-benzenediamine;JACS-1345627-73-7;1,2-Benzenediamine, 3,6-dibromo-4,5-difluoro-;3,6-dibromo-4,5-difluorobenzene-1,2-diamine | | CAS: | 1345627-73-7 | | MF: | C6H4Br2F2N2 | | MW: | 301.91 | | EINECS: | | | Product Categories: | | | Mol File: | 1345627-73-7.mol |  |
| | 3,6-dibromo-4,5-difluoro-1,2-phenylenediamine Chemical Properties |
| Boiling point | 327.4±37.0 °C(Predicted) | | density | 2.239±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 0.37±0.10(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C6H4Br2F2N2/c7-1-3(9)4(10)2(8)6(12)5(1)11/h11-12H2 | | InChIKey | CVQSLVCQGXUJQU-UHFFFAOYSA-N | | SMILES | C1(N)=C(Br)C(F)=C(F)C(Br)=C1N |
| | 3,6-dibromo-4,5-difluoro-1,2-phenylenediamine Usage And Synthesis |
| | 3,6-dibromo-4,5-difluoro-1,2-phenylenediamine Preparation Products And Raw materials |
|