|
|
| | 2,9-dibromo-1,10-phenanthroline-5,6-dione Basic information |
| Product Name: | 2,9-dibromo-1,10-phenanthroline-5,6-dione | | Synonyms: | 2,9-dibromo-1,10-phenanthroline-5,6-dione;1,10-Phenanthroline-5,6-dione, 2,9-dibromo- | | CAS: | 943861-95-8 | | MF: | C12H4Br2N2O2 | | MW: | 367.98 | | EINECS: | | | Product Categories: | | | Mol File: | 943861-95-8.mol |  |
| | 2,9-dibromo-1,10-phenanthroline-5,6-dione Chemical Properties |
| Boiling point | 574.3±50.0 °C(Predicted) | | density | 2.068±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | -4.68±0.20(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C12H4Br2N2O2/c13-7-3-1-5-9(15-7)10-6(12(18)11(5)17)2-4-8(14)16-10/h1-4H | | InChIKey | PVWHEXBKSREKSB-UHFFFAOYSA-N | | SMILES | N1C2=C(C(=O)C(=O)C3=C2N=C(Br)C=C3)C=CC=1Br |
| | 2,9-dibromo-1,10-phenanthroline-5,6-dione Usage And Synthesis |
| | 2,9-dibromo-1,10-phenanthroline-5,6-dione Preparation Products And Raw materials |
|