|
|
| | Methyl 2-(4-(4-chlorobutanoyl)phenyl)-2-methylpropanoate Basic information |
| | Methyl 2-(4-(4-chlorobutanoyl)phenyl)-2-methylpropanoate Chemical Properties |
| Boiling point | 396.5±32.0 °C(Predicted) | | density | 1.121 | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C15H19ClO3/c1-15(2,14(18)19-3)12-8-6-11(7-9-12)13(17)5-4-10-16/h6-9H,4-5,10H2,1-3H3 | | InChIKey | ULWORPZJUIFPIC-UHFFFAOYSA-N | | SMILES | C(C)(C)(C1=CC=C(C=C1)C(CCCCl)=O)C(OC)=O | | CAS DataBase Reference | 154477-54-0(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HS Code | 2915601990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| | Methyl 2-(4-(4-chlorobutanoyl)phenyl)-2-methylpropanoate Usage And Synthesis |
| Chemical Properties | Brown Oil | | Uses | Fexofenadine intermediate. Antihistaminic and antiallergic agent | | Uses | 4-(4-Chloro-1-oxobutyl)-α,α-dimethylbenzeneacetic Acid Methyl Ester is a fexofenadine (F322490) intermediate. Antihistaminic and antiallergic agent. |
| | Methyl 2-(4-(4-chlorobutanoyl)phenyl)-2-methylpropanoate Preparation Products And Raw materials |
|