|
|
| | Benzyltrimethylammonium hydroxide Basic information |
| | Benzyltrimethylammonium hydroxide Chemical Properties |
| Melting point | 80 °C | | Boiling point | 65°C | | density | 1.059 g/mL at 25 °C | | vapor pressure | 0Pa at 25℃ | | refractive index | n20/D 1.43 | | Fp | 60 °F | | storage temp. | Store below +30°C. | | solubility | Miscible with alcohols, hydrocarbons, aromatic hydrocarbons and halogenated solvents. | | form | Solution | | color | Clear slightly yellow | | PH | 12 (20°C in H2O, undiluted) | | explosive limit | 5.50-36.50% | | Water Solubility | Miscible with water, hydrocarbons, aromatic hydrocarbons and halogenated solvents. | | Sensitive | Air Sensitive | | BRN | 3917256 | | Exposure limits | ACGIH: TWA 200 ppm; STEL 250 ppm (Skin)
OSHA: TWA 200 ppm(260 mg/m3)
NIOSH: IDLH 6000 ppm; TWA 200 ppm(260 mg/m3); STEL 250 ppm(325 mg/m3) | | InChI | 1S/C10H16N.H2O/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H2/q+1;/p-1 | | InChIKey | NDKBVBUGCNGSJJ-UHFFFAOYSA-M | | SMILES | [OH-].C[N+](C)(C)Cc1ccccc1 | | LogP | -3 at 20℃ | | CAS DataBase Reference | 100-85-6(CAS DataBase Reference) | | EPA Substance Registry System | Benzyltrimethylammonium hydroxide (100-85-6) |
| Hazard Codes | C,T,F | | Risk Statements | 34-39/23/24/25-23/24/25-11 | | Safety Statements | 26-36/37/39-45-46-16-28A-7 | | RIDADR | UN 3267 8/PG 2 | | WGK Germany | 1 | | RTECS | BO8575000 | | F | 9-23 | | Autoignition Temperature | 455°C | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29239000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1A | | Toxicity | LDLo scu-mus: 35 mg/kg JPETAB 28,367,26 |
| | Benzyltrimethylammonium hydroxide Usage And Synthesis |
| Chemical Properties | CLEAR SLIGHTLY YELLOW SOLUTION | | Uses | Benzyltrimethylammonium hydroxide is used as a phase-transfer catalyst. It is also used in aldol condensation reactions and base-catalyzed dehydration reactions. Further, it serves as a strong organic base and used in Horner-Wadsworth-Emmons olefination reactions. In addition, it is an active component in the formulation, which is used in silicon wafer cleaning applications. | | Uses | Benzyltrimethylammonium hydroxide can be used:
- As a base in the synthesis of activated ynesulfonamides and tertiary enesulfonamides.
- In the synthesis of 3-indolyl-3-hydroxy oxindoles by treating isatin with indole.
- As a precursor for the preparation of quaternary ammonium acetate, benzyltrimethylammonium acetate (NBz111AcO). NBz111AcO solution in DMSO can be used to dissolve cellulose.
| | Flammability and Explosibility | Not classified | | Safety Profile | Poison by subcutaneous route. Astrong base. When heated to decomposition it emits toxicfumes of NH3 and NOx. | | Purification Methods | A 38% solution (as supplied) is decolorized (charcoal), then evaporated under reduced pressure to a syrup, with final drying at 75o/1mm pressure. The anhydrous base is obtained by prolonged drying over P2O5 in a vacuum desiccator. [Beilstein 12 IV 2162.] | | Toxics Screening Level | The initial threshold screening level (ITSL) is 0.1 μg/m3 based on annual average time. |
| | Benzyltrimethylammonium hydroxide Preparation Products And Raw materials |
|