|
|
| | 1,1'-FERROCENEDIMETHANOL Basic information |
| Product Name: | 1,1'-FERROCENEDIMETHANOL | | Synonyms: | 1,1′-Ferrocenedimethanol 98%;Ferrocene derivatives;1,1′-Ferrocenylbis(methanol);Cyclopentadienemethanol;1,1'-Ferrocenedimethanol, 98%,;1,1'-Ferrocenedimethanol;Ferrocene, 1,1′-bis(hydroxymethyl)-;1,1'-Ferrocenedimethanol | | CAS: | 1291-48-1 | | MF: | C12H14FeO210* | | MW: | 246.08 | | EINECS: | | | Product Categories: | Industrial/Fine Chemicals;Catalysis and Inorganic Chemistry;Aromatic alcohols and diols;Chemical Synthesis | | Mol File: | 1291-48-1.mol |  |
| | 1,1'-FERROCENEDIMETHANOL Chemical Properties |
| Melting point | 106-108 °C(lit.) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | Yellow to brown Solid | | InChI | 1S/2C6H7O.Fe/c2*7-5-6-3-1-2-4-6;/h2*1-4,7H,5H2; | | InChIKey | ZFFYTNSKVXIYIE-UHFFFAOYSA-N | | SMILES | [Fe].OC[C]1[CH][CH][CH][CH]1.OC[C]2[CH][CH][CH][CH]2 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | 1,1'-FERROCENEDIMETHANOL Usage And Synthesis |
| Chemical Properties | Orange crystals | | reaction suitability | core: iron
reagent type: catalyst | | Purification Methods | It is obtained from the diacid by LiAlH4 reduction and recrystallised from Et2O/pet ether. [Reinhart et al. J Am Chem Soc 82 4111 1960, Beilstein 16 IV 1795.] |
| | 1,1'-FERROCENEDIMETHANOL Preparation Products And Raw materials |
|