|
|
| | 3',4',5'-TRIMETHOXYACETOPHENONE Basic information |
| Product Name: | 3',4',5'-TRIMETHOXYACETOPHENONE | | Synonyms: | LABOTEST-BB LT00233192;1-(3,4,5-Trimethoxyphenyl)ethanone;Acetophenone, 3',4',5'-trimethoxy;3,4,5-'Trimethoxyacetophenone98%;Ethanone, 1-(3,4,5-trimethoxyphenyl)-;AKOS 217-16;3',4',5'-Trimethoxyacetophenone,99+%;3',4',5'-Trimethoxyacetophenone 98% | | CAS: | 1136-86-3 | | MF: | C11H14O4 | | MW: | 210.23 | | EINECS: | 214-501-9 | | Product Categories: | Aromatic Acetophenones & Derivatives (substituted);C11 to C12;Carbonyl Compounds;Ketones | | Mol File: | 1136-86-3.mol |  |
| | 3',4',5'-TRIMETHOXYACETOPHENONE Chemical Properties |
| Melting point | 78-80 °C(lit.) | | Boiling point | 173-174 °C10 mm Hg(lit.) | | density | 1.1922 (rough estimate) | | refractive index | 1.5075 (estimate) | | Fp | 173-174°C/10mm | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow to Light orange | | Water Solubility | Slightly soluble in water. | | BRN | 1463133 | | InChI | InChI=1S/C11H14O4/c1-7(12)8-5-9(13-2)11(15-4)10(6-8)14-3/h5-6H,1-4H3 | | InChIKey | VUGQIIQFXCXZJU-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(OC)=C(OC)C(OC)=C1)C | | CAS DataBase Reference | 1136-86-3(CAS DataBase Reference) | | NIST Chemistry Reference | Ethanone, 1-(3,4,5-trimethoxyphenyl)-(1136-86-3) |
| | 3',4',5'-TRIMETHOXYACETOPHENONE Usage And Synthesis |
| Chemical Properties | white to yellow crystalline powder | | Uses | 3',4',5'-Trimethoxyacetophenone is used in agrochemical, pharmaceutical and dyestuff field . | | Definition | ChEBI: A member of the class of acetophenones that is acetophenone substituted by methoxy groups at positions 3, 4 and 5 respectively. | | Preparation | Obtained by treatment of a mixture of methyl 3,4,5-trimethoxybenzoate (m.p. 82°) and ethyl acetate with sodium on a water boiler for 8 h, then with 25% sulfuric acid. |
| | 3',4',5'-TRIMETHOXYACETOPHENONE Preparation Products And Raw materials |
|