|
|
| | Fmoc-N-methyl-L-glutamic acid 5-tert-butyl ester Basic information |
| | Fmoc-N-methyl-L-glutamic acid 5-tert-butyl ester Chemical Properties |
| Melting point | 116-119°C | | Boiling point | 612.3±55.0 °C(Predicted) | | density | 1.220±0.06 g/cm3(Predicted) | | storage temp. | Store at +2°C to +8°C. | | solubility | Soluble in water or 1% acetic acid | | pka | 3.72±0.10(Predicted) | | form | Powder | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C25H29NO6/c1-25(2,3)32-22(27)14-13-21(23(28)29)26(4)24(30)31-15-20-18-11-7-5-9-16(18)17-10-6-8-12-19(17)20/h5-12,20-21H,13-15H2,1-4H3,(H,28,29)/t21-/m0/s1 | | InChIKey | FVUASVBQADLDRO-NRFANRHFSA-N | | SMILES | C(O)(=O)[C@H](CCC(OC(C)(C)C)=O)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C | | CAS DataBase Reference | 200616-40-6(CAS DataBase Reference) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-N-methyl-L-glutamic acid 5-tert-butyl ester Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Fmoc-protected N-methyl amino acid. N-methyl amino acids have shown enhanced biological stability in peptides compared to standard amino acids. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-N-methyl-L-glutamic acid 5-tert-butyl ester Preparation Products And Raw materials |
|