| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Ethylbenzene-d5
CAS:20302-26-5
Remarks:CS-C-00492
|
| Company Name: |
Clearsynth Canada Inc.
|
| Tel: |
+1.415.685.4395 |
| Email: |
enquiry@clearsynth.com |
| Products Intro: |
Product Name:Ethylbenzene-2,3,4,5,6 D5
CAS:20302-26-5
Remarks:CS-O-15391
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:Ethylbenzene-2,3,4,5,6-d5
CAS:20302-26-5
Purity:98% Package:5g;25g;100g Remarks:Environmental Standards
|
|
| | ETHYLBENZENE-2,3,4,5,6-D5 Basic information |
| Product Name: | ETHYLBENZENE-2,3,4,5,6-D5 | | Synonyms: | 1-Ethyl(2,3,4,5,6-2H5)benzene;ETHYLBENZENE-RING-D5, 97 ATOM % D;ETHYLBENZENE-D5, (RING-D5) 98 ATOM % D;Ethyl(benzene-D5);ETHYLBENZENE (RING-D5);ETHYLBENZENE-2,3,4,5,6-D5;Ethyl(benzene-d5) | | CAS: | 20302-26-5 | | MF: | C8H5D5 | | MW: | 111.2 | | EINECS: | | | Product Categories: | Alphabetical Listings;E-F;Stable Isotopes | | Mol File: | 20302-26-5.mol |  |
| | ETHYLBENZENE-2,3,4,5,6-D5 Chemical Properties |
| Boiling point | 136 °C(lit.) | | density | 0.908 g/mL at 25 °C | | Fp | 72 °F | | InChI | 1S/C8H10/c1-2-8-6-4-3-5-7-8/h3-7H,2H2,1H3/i3D,4D,5D,6D,7D | | InChIKey | YNQLUTRBYVCPMQ-DKFMXDSJSA-N | | SMILES | [2H]c1c([2H])c([2H])c(CC)c([2H])c1[2H] | | EPA Substance Registry System | Ethylbenzene-d5 (20302-26-5) |
| Hazard Codes | F,Xn | | Risk Statements | 11-20 | | Safety Statements | 16-24/25-29 | | RIDADR | UN 1175 3/PG 2 | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Inhalation
Aquatic Chronic 3
Asp. Tox. 1
Flam. Liq. 2
STOT RE 2 |
| | ETHYLBENZENE-2,3,4,5,6-D5 Usage And Synthesis |
| Uses | Ethylbenzene-2,3,4,5,6-d5 (CAS# 20302-26-5) is a useful isotopically labeled research compound. |
| | ETHYLBENZENE-2,3,4,5,6-D5 Preparation Products And Raw materials |
|