|
|
| | 1-METHYL-1H-PYRAZOLO[3,4-B]PYRIDIN-3-YLAMINE Basic information |
| Product Name: | 1-METHYL-1H-PYRAZOLO[3,4-B]PYRIDIN-3-YLAMINE | | Synonyms: | 1-METHYL-1H-PYRAZOLO[3,4-B]PYRIDIN-3-AMINE;1-METHYL-1H-PYRAZOLO[3,4-B]PYRIDIN-3-YLAMINE;1-Methyl-1H-pyrazolo[3,4-b]pyridin-3-ylamine ,97%;3-amino-1-methylpyrazolo<3,4-b>pyridine;1-Methyl-3-aMino-1H-pyrazolo[3,4-b]pyridine;1-Methyl-1H-pyrazolo[3,4-b]pyridin-3-ylaMine (en);109688;3-Amino-1-methyl-1H-pyrazolo[3,4-b]pyridine | | CAS: | 72583-83-6 | | MF: | C7H8N4 | | MW: | 148.17 | | EINECS: | | | Product Categories: | | | Mol File: | 72583-83-6.mol | ![1-METHYL-1H-PYRAZOLO[3,4-B]PYRIDIN-3-YLAMINE Structure](CAS/GIF/72583-83-6.gif) |
| | 1-METHYL-1H-PYRAZOLO[3,4-B]PYRIDIN-3-YLAMINE Chemical Properties |
| Melting point | 104-106°C | | Boiling point | 340.7±22.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 5.31±0.30(Predicted) | | form | solid | | Appearance | Light yellow to green yellow Solid | | InChI | InChI=1S/C7H8N4/c1-11-7-5(6(8)10-11)3-2-4-9-7/h2-4H,1H3,(H2,8,10) | | InChIKey | SHBCCEDOUTZFFW-UHFFFAOYSA-N | | SMILES | C12N(C)N=C(N)C1=CC=CN=2 |
| Hazard Codes | T | | Risk Statements | 25-36-36/37/38-22 | | Safety Statements | 26-45-36/37/39-22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-METHYL-1H-PYRAZOLO[3,4-B]PYRIDIN-3-YLAMINE Usage And Synthesis |
| Chemical Properties | Light yellow solid |
| | 1-METHYL-1H-PYRAZOLO[3,4-B]PYRIDIN-3-YLAMINE Preparation Products And Raw materials |
|